![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| -----------/ | 26-Jul-2007 11:45 | - | |
| 2 BAL 2 NEG/ | 23-Jun-2007 03:24 | - | |
| 5even.5/ | 23-Jun-2007 03:24 | - | |
| 113/ | 23-Jun-2007 03:23 | - | |
| 1970 extensions/ | 23-Jun-2007 03:24 | - | |
| AE/ | 23-Jun-2007 03:27 | - | |
| AFX/ | 23-Jun-2007 03:30 | - | |
| APC/ | 23-Jun-2007 03:33 | - | |
| A Tribe Called Quest/ | 23-Jun-2007 03:24 | - | |
| Abstract keal agram/ | 23-Jun-2007 03:24 | - | |
| Acoustica/ | 23-Jun-2007 03:24 | - | |
| Add N To (X)/ | 23-Jun-2007 03:24 | - | |
| Ahmad Jahmal/ | 23-Jun-2007 03:30 | - | |
| Air/ | 23-Jun-2007 03:30 | - | |
| Akira Rabelais/ | 23-Jun-2007 03:30 | - | |
| Aktion Pak/ | 23-Jun-2007 03:31 | - | |
| Albigeois/ | 23-Jun-2007 03:31 | - | |
| Al di Meola/ | 23-Jun-2007 03:31 | - | |
| Alka Rex/ | 23-Jun-2007 03:31 | - | |
| Amon Tobin/ | 23-Jun-2007 03:32 | - | |
| Andrea Parker/ | 23-Jun-2007 03:32 | - | |
| Andrew Thomas/ | 23-Jun-2007 03:32 | - | |
| Annie Gosfield/ | 23-Jun-2007 03:32 | - | |
| Anniemal/ | 23-Jun-2007 03:32 | - | |
| Antonelli Electr_/ | 23-Jun-2007 03:32 | - | |
| Apparat/ | 23-Jun-2007 03:33 | - | |
| April March/ | 23-Jun-2007 03:33 | - | |
| Arabstrap/ | 23-Jun-2007 03:34 | - | |
| Architecture in Helsinki/ | 23-Jun-2007 03:34 | - | |
| Ark/ | 23-Jun-2007 03:34 | - | |
| Auburn Lull/ | 23-Jun-2007 03:34 | - | |
| Aziza Mustafa Zadeh/ | 23-Jun-2007 03:34 | - | |
| B. Fleischmann/ | 23-Jun-2007 03:35 | - | |
| Babatunde Olatunji/ | 23-Jun-2007 03:35 | - | |
| Ban On a Can/ | 23-Jun-2007 03:35 | - | |
| Basement Jaxx/ | 23-Jun-2007 03:36 | - | |
| Battles/ | 23-Jun-2007 03:36 | - | |
| Beefcake/ | 23-Jun-2007 03:36 | - | |
| Beirut/ | 23-Jun-2007 03:36 | - | |
| Beirut Cafe/ | 23-Jun-2007 03:36 | - | |
| Beyonce/ | 23-Jun-2007 03:36 | - | |
| Big Bud/ | 23-Jun-2007 03:36 | - | |
| Biosphere/ | 23-Jun-2007 03:37 | - | |
| Bireli Lagrene Ensemble/ | 23-Jun-2007 03:37 | - | |
| Bit Meddler/ | 23-Jun-2007 03:37 | - | |
| Bjork remixes/ | 23-Jun-2007 03:37 | - | |
| Blockhead/ | 23-Jun-2007 03:37 | - | |
| Blondie/ | 23-Jun-2007 03:38 | - | |
| Board of Canada/ | 23-Jun-2007 03:38 | - | |
| Bogdan Raczynski/ | 23-Jun-2007 03:38 | - | |
| Bola/ | 23-Jun-2007 03:38 | - | |
| Bong Ra vs Venetian Snares/ | 23-Jun-2007 03:39 | - | |
| Boom Bip/ | 23-Jun-2007 03:39 | - | |
| Bootsy Collins/ | 23-Jun-2007 03:39 | - | |
| Boredoms/ | 23-Jun-2007 03:39 | - | |
| Bran Van 3000/ | 23-Jun-2007 03:39 | - | |
| Brazilian Girls/ | 23-Jun-2007 03:39 | - | |
| Breakin' Records/ | 23-Jun-2007 03:39 | - | |
| Brian Eno & Harold Budd/ | 23-Jun-2007 03:39 | - | |
| Brian Eno/ | 23-Jun-2007 03:39 | - | |
| Brigitte Fontaine/ | 23-Jun-2007 03:39 | - | |
| Broadcast/ | 23-Jun-2007 03:40 | - | |
| Brubeck/ | 23-Jun-2007 03:40 | - | |
| Buju Banton/ | 23-Jun-2007 03:40 | - | |
| CLASSIQUE/ | 23-Jun-2007 03:45 | - | |
| Cabaret Voltaire/ | 27-Jul-2007 08:32 | - | |
| Cat Power/ | 23-Jun-2007 03:40 | - | |
| Ceephax Acid Crew/ | 23-Jun-2007 03:41 | - | |
| Cex/ | 23-Jun-2007 03:41 | - | |
| Charles Ives/ | 23-Jun-2007 03:41 | - | |
| Chevron/ | 23-Jun-2007 03:42 | - | |
| Chillosophy/ | 23-Jun-2007 03:42 | - | |
| ChkChkChk (!!!)/ | 23-Jun-2007 03:42 | - | |
| Chosen Lords/ | 23-Jun-2007 03:42 | - | |
| Claude Chalhoub/ | 23-Jun-2007 03:45 | - | |
| Clicks, Acid 'n' Disco/ | 23-Jun-2007 03:45 | - | |
| Clogs/ | 23-Jun-2007 03:46 | - | |
| Cocteau Twins/ | 23-Jun-2007 03:46 | - | |
| Cornelius/ | 23-Jun-2007 03:46 | - | |
| Cujo/ | 23-Jun-2007 03:46 | - | |
| Cut Chemist/ | 23-Jun-2007 03:46 | - | |
| D-Styles/ | 23-Jun-2007 03:46 | - | |
| DJ Abdel/ | 23-Jun-2007 03:49 | - | |
| DJ Food & DK/ | 23-Jun-2007 03:49 | - | |
| DJ Kicks Series - DJ Cam/ | 23-Jun-2007 03:50 | - | |
| DJ Logic/ | 23-Jun-2007 03:51 | - | |
| DJ Mehdi/ | 23-Jun-2007 03:51 | - | |
| DJ Mitsu the Beats/ | 23-Jun-2007 03:51 | - | |
| DJ Olive/ | 23-Jun-2007 03:51 | - | |
| DJ Vadim/ | 23-Jun-2007 03:52 | - | |
| DJ Z-Trip/ | 23-Jun-2007 03:52 | - | |
| Daedelus/ | 23-Jun-2007 03:47 | - | |
| Daft Punk/ | 23-Jun-2007 03:47 | - | |
| Dalek/ | 23-Jun-2007 03:47 | - | |
| Dan The Automator/ | 23-Jun-2007 03:47 | - | |
| Dancer in the Dark/ | 23-Jun-2007 03:47 | - | |
| Dani Siciliano/ | 23-Jun-2007 03:47 | - | |
| Das Bierbeben/ | 23-Jun-2007 03:47 | - | |
| Datach'i/ | 23-Jun-2007 03:47 | - | |
| Death Ambient/ | 23-Jun-2007 03:47 | - | |
| Del The Funkyhomosapien/ | 23-Jun-2007 03:48 | - | |
| Demon Days/ | 23-Jun-2007 03:48 | - | |
| Demonbag/ | 23-Jun-2007 03:48 | - | |
| Denim And Diamonds/ | 23-Jun-2007 03:48 | - | |
| Destrcution of Syntax/ | 23-Jun-2007 03:48 | - | |
| Devenda Banhart/ | 23-Jun-2007 03:48 | - | |
| Dimitri from Paris/ | 23-Jun-2007 03:48 | - | |
| Dino Felipe/ | 23-Jun-2007 03:48 | - | |
| Dizee Rascal/ | 23-Jun-2007 03:49 | - | |
| Dj Shadow/ | 23-Jun-2007 03:52 | - | |
| Dj Spooky/ | 23-Jun-2007 03:49 | - | |
| Dj krush/ | 23-Jun-2007 03:51 | - | |
| Donald Byrd/ | 23-Jun-2007 03:53 | - | |
| Downtown Science/ | 23-Jun-2007 03:53 | - | |
| Dracula/ | 23-Jun-2007 03:53 | - | |
| E_Vax/ | 23-Jun-2007 03:54 | - | |
| Earth Wind & Fire/ | 23-Jun-2007 03:53 | - | |
| Echo & the Bunymen/ | 23-Jun-2007 03:53 | - | |
| Ectomorph/ | 23-Jun-2007 03:53 | - | |
| Edgard Varèse/ | 23-Jun-2007 03:53 | - | |
| Electric Tonic/ | 23-Jun-2007 03:54 | - | |
| Ellen Allien/ | 23-Jun-2007 03:54 | - | |
| Eric b & Rakim/ | 23-Jun-2007 03:54 | - | |
| Feadz/ | 23-Jun-2007 03:54 | - | |
| Fear of a Black Tangent/ | 23-Jun-2007 03:54 | - | |
| Feiruz/ | 23-Jun-2007 03:55 | - | |
| Felix Da Housecat/ | 23-Jun-2007 03:55 | - | |
| Fennesz/ | 23-Jun-2007 03:55 | - | |
| Ferenc/ | 23-Jun-2007 03:55 | - | |
| Flanger/ | 23-Jun-2007 03:55 | - | |
| Found Sound/ | 23-Jun-2007 03:55 | - | |
| Franz Ferdinand/ | 23-Jun-2007 03:56 | - | |
| Freeform/ | 23-Jun-2007 03:56 | - | |
| Friday Afternoon in the Universe/ | 23-Jun-2007 03:56 | - | |
| Funky Porcini/ | 23-Jun-2007 03:56 | - | |
| Gang Starr/ | 23-Jun-2007 03:56 | - | |
| Gescom/ | 23-Jun-2007 03:57 | - | |
| Glen Velez/ | 23-Jun-2007 03:57 | - | |
| Gnarls Barkley/ | 23-Jun-2007 03:57 | - | |
| Gold Chains/ | 23-Jun-2007 03:57 | - | |
| Goldfrapp/ | 23-Jun-2007 03:57 | - | |
| Graeme Revell/ | 23-Jun-2007 03:58 | - | |
| Grateful Dead/ | 23-Jun-2007 03:58 | - | |
| Harmonic 33/ | 23-Jun-2007 03:58 | - | |
| Heroin + Remixes/ | 23-Jun-2007 03:58 | - | |
| Hexstatic/ | 23-Jun-2007 03:59 | - | |
| Home Video/ | 23-Jun-2007 03:59 | - | |
| Hubert Laws/ | 23-Jun-2007 03:59 | - | |
| IAM/ | 23-Jun-2007 03:59 | - | |
| Ian Brown/ | 23-Jun-2007 03:59 | - | |
| Iannis Xenakis/ | 23-Jun-2007 03:59 | - | |
| Illy B/ | 23-Jun-2007 04:00 | - | |
| Jackson and His Computer Band/ | 23-Jun-2007 04:00 | - | |
| Jaga Jazzist/ | 23-Jun-2007 04:01 | - | |
| James Brown/ | 23-Jun-2007 04:01 | - | |
| Jamie Lidell/ | 23-Jun-2007 04:01 | - | |
| Jan Jelinek/ | 23-Jun-2007 04:02 | - | |
| Jan Johansson/ | 23-Jun-2007 04:02 | - | |
| Jean-Luc Ponty/ | 23-Jun-2007 04:02 | - | |
| Jega/ | 23-Jun-2007 04:03 | - | |
| Jim ORourke/ | 23-Jun-2007 04:03 | - | |
| Jimi Tenor/ | 23-Jun-2007 04:03 | - | |
| Jmimmy Edgar/ | 23-Jun-2007 04:03 | - | |
| John Zorn/ | 23-Jun-2007 04:04 | - | |
| Jonny Greenwood/ | 23-Jun-2007 04:04 | - | |
| Jose Gonzalez/ | 23-Jun-2007 04:04 | - | |
| Karat Compilation/ | 23-Jun-2007 04:05 | - | |
| Kevin Blechdom/ | 23-Jun-2007 04:05 | - | |
| Kid A/ | 23-Jun-2007 04:05 | - | |
| Klimek/ | 23-Jun-2007 04:06 | - | |
| Kocani Orkestar/ | 23-Jun-2007 04:06 | - | |
| Kris Kross/ | 23-Jun-2007 04:07 | - | |
| Kronos Quartet/ | 23-Jun-2007 04:08 | - | |
| L'orchestre de contrebasses/ | 23-Jun-2007 04:08 | - | |
| LFO/ | 23-Jun-2007 04:10 | - | |
| LTJ Bukem/ | 23-Jun-2007 04:11 | - | |
| Ladytron/ | 23-Jun-2007 04:09 | - | |
| Laurent Garnier/ | 23-Jun-2007 04:09 | - | |
| Lawrence/ | 23-Jun-2007 04:09 | - | |
| Le Tigre/ | 23-Jun-2007 04:09 | - | |
| Leafcutter John/ | 23-Jun-2007 04:10 | - | |
| Legowelt/ | 23-Jun-2007 04:10 | - | |
| Lesli Dalaba/ | 23-Jun-2007 04:10 | - | |
| Lesser/ | 23-Jun-2007 04:10 | - | |
| Lost Highway/ | 23-Jun-2007 04:11 | - | |
| Lover's Acid/ | 23-Jun-2007 04:11 | - | |
| Luiz Bonfá/ | 23-Jun-2007 04:11 | - | |
| Luke Vibert/ | 23-Jun-2007 04:12 | - | |
| MF Doom/ | 23-Jun-2007 04:15 | - | |
| Madlib/ | 23-Jun-2007 04:12 | - | |
| Mahogany/ | 23-Jun-2007 04:12 | - | |
| Mamady Keita/ | 23-Jun-2007 04:12 | - | |
| Manu Chao/ | 23-Jun-2007 04:13 | - | |
| Manu le Malin/ | 23-Jun-2007 04:13 | - | |
| Marcus Guentner/ | 23-Jun-2007 04:13 | - | |
| Mariel Ito/ | 23-Jun-2007 04:13 | - | |
| Mark Broom/ | 23-Jun-2007 04:13 | - | |
| Marvin Gaye/ | 23-Jun-2007 04:13 | - | |
| Massive attack/ | 23-Jun-2007 04:13 | - | |
| Matmos/ | 23-Jun-2007 04:13 | - | |
| Matmos and J Lesser/ | 23-Jun-2007 04:13 | - | |
| Matt Elliott/ | 23-Jun-2007 04:13 | - | |
| Matthew Herbert/ | 23-Jun-2007 04:14 | - | |
| Max Richter/ | 23-Jun-2007 04:14 | - | |
| Medulla/ | 23-Jun-2007 04:15 | - | |
| Melodies From Mars/ | 23-Jun-2007 04:15 | - | |
| Melt Banana/ | 23-Jun-2007 04:15 | - | |
| Mephista/ | 23-Jun-2007 04:15 | - | |
| Metalux/ | 23-Jun-2007 04:15 | - | |
| Method Man/ | 23-Jun-2007 04:15 | - | |
| Michael Mayer/ | 23-Jun-2007 04:15 | - | |
| Midnite Blasters/ | 23-Jun-2007 04:16 | - | |
| Mike Patton-John Zorn-Ikue Mori/ | 23-Jun-2007 04:16 | - | |
| Milanese/ | 23-Jun-2007 04:16 | - | |
| Miles Davis/ | 23-Jun-2007 04:17 | - | |
| Minimalist/ | 23-Jun-2007 04:17 | - | |
| Miss Kittin/ | 23-Jun-2007 04:17 | - | |
| Missy Elliot/ | 23-Jun-2007 04:17 | - | |
| Modeselektor/ | 22-Dec-2008 14:31 | - | |
| Mogwai/ | 23-Jun-2007 04:18 | - | |
| Morrissey/ | 23-Jun-2007 04:18 | - | |
| Morton Feldman/ | 23-Jun-2007 04:18 | - | |
| Muddy Waters/ | 23-Jun-2007 04:18 | - | |
| Murs 316 the 9th Edition/ | 23-Jun-2007 04:18 | - | |
| My Bloody Valentine/ | 23-Jun-2007 04:19 | - | |
| Nautilis/ | 23-Jun-2007 04:19 | - | |
| New Order/ | 23-Jun-2007 04:19 | - | |
| Nightmares On Wax/ | 23-Jun-2007 04:19 | - | |
| Nils Petter Molvaer/ | 29-Jul-2007 22:01 | - | |
| Nobukazu Takemura/ | 23-Jun-2007 04:20 | - | |
| Noto Alva/ | 23-Jun-2007 04:20 | - | |
| Nouvelle Vague/ | 23-Jun-2007 04:20 | - | |
| Nurse With Wound/ | 23-Jun-2007 04:20 | - | |
| Of Montreal/ | 23-Jun-2007 04:20 | - | |
| Orchestra of Bubbles/ | 23-Jun-2007 04:20 | - | |
| Organum/ | 23-Jun-2007 04:21 | - | |
| Orgy/ | 23-Jun-2007 04:21 | - | |
| Otis Redding/ | 23-Jun-2007 04:21 | - | |
| Otto Von Schirach/ | 23-Jun-2007 04:21 | - | |
| P.A.L/ | 23-Jun-2007 04:21 | - | |
| PJ Harvey/ | 08-Aug-2007 10:57 | - | |
| Para One/ | 23-Jun-2007 04:21 | - | |
| Parliament/ | 23-Jun-2007 04:21 | - | |
| Parts In The Post/ | 23-Jun-2007 04:22 | - | |
| Philip Glass/ | 23-Jun-2007 04:22 | - | |
| Phillip Glass/ | 23-Jun-2007 04:22 | - | |
| Phon.O/ | 23-Jun-2007 04:23 | - | |
| Pierre Boulez & Luciano Berio/ | 23-Jun-2007 04:23 | - | |
| Pitamaha- Music From Bali/ | 08-Aug-2007 10:57 | - | |
| Planet Mu - Cosmic Forces Of Mu/ | 23-Jun-2007 04:24 | - | |
| Planet Mu Allstars - Criminal '02 12''/ | 23-Jun-2007 04:24 | - | |
| Plastikman/ | 23-Jun-2007 04:24 | - | |
| Plug/ | 23-Jun-2007 04:24 | - | |
| Pop Ambient/ | 23-Jun-2007 04:25 | - | |
| Portishead & Kraftwerk/ | 23-Jun-2007 04:25 | - | |
| Posthuman/ | 23-Jun-2007 04:25 | - | |
| Praxis/ | 23-Jun-2007 04:26 | - | |
| Prefuse 73/ | 23-Jun-2007 04:26 | - | |
| Prodigy/ | 23-Jun-2007 04:26 | - | |
| Public Enemy/ | 23-Jun-2007 04:26 | - | |
| Quannum/ | 08-Aug-2007 11:09 | - | |
| Rae & Christian/ | 08-Aug-2007 11:09 | - | |
| Raison d'être/ | 08-Aug-2007 11:17 | - | |
| Rameau/ | 08-Aug-2007 11:32 | - | |
| Ratatat/ | 08-Aug-2007 12:01 | - | |
| Ravi Shankar/ | 08-Aug-2007 12:19 | - | |
| Regina Spektor/ | 08-Aug-2007 12:49 | - | |
| S-Range/ | 09-Aug-2007 02:13 | - | |
| SYR 5/ | 09-Aug-2007 05:49 | - | |
| Saint Germain Des Pres Cafe II/ | 23-Jun-2007 04:29 | - | |
| Saul Williams/ | 23-Jun-2007 04:29 | - | |
| Serge Gainsbourg/ | 08-Aug-2007 12:49 | - | |
| Skinny Puppy/ | 23-Jun-2007 04:30 | - | |
| Sleepy Time Gorilla Museum/ | 23-Jun-2007 04:30 | - | |
| Sleepytime Gorilla Museum/ | 23-Jun-2007 04:30 | - | |
| Sly And The Family Stone/ | 23-Jun-2007 04:30 | - | |
| Smackulator/ | 23-Jun-2007 04:30 | - | |
| Solex/ | 23-Jun-2007 04:30 | - | |
| Solo Bassfeder/ | 08-Aug-2007 13:48 | - | |
| Soma Sonic/ | 08-Aug-2007 15:01 | - | |
| Sonny Clark/ | 08-Aug-2007 15:20 | - | |
| Souad Massi/ | 08-Aug-2007 15:47 | - | |
| Speakerboxxx_The Love Below/ | 08-Aug-2007 16:35 | - | |
| Speedy J/ | 08-Aug-2007 17:57 | - | |
| Speicher/ | 08-Aug-2007 18:27 | - | |
| Squaremeter/ | 08-Aug-2007 19:04 | - | |
| Squarepusher/ | 09-Aug-2007 02:11 | - | |
| Steely Dan/ | 09-Aug-2007 02:23 | - | |
| Stephan Mathieu/ | 09-Aug-2007 02:39 | - | |
| Stereo Total/ | 09-Aug-2007 02:46 | - | |
| Stereolab/ | 09-Aug-2007 02:59 | - | |
| Steve Roden/ | 09-Aug-2007 04:08 | - | |
| Sun Ra/ | 09-Aug-2007 04:08 | - | |
| Susie Ibarra/ | 09-Aug-2007 04:41 | - | |
| Susumu Yokota/ | 09-Aug-2007 05:11 | - | |
| Sven Väth/ | 09-Aug-2007 05:34 | - | |
| T.A.G.C_/ | 09-Aug-2007 05:49 | - | |
| T.Raumschmiere/ | 09-Aug-2007 06:01 | - | |
| TTC/ | 23-Jun-2007 04:39 | - | |
| Tarek Atoui/ | 09-Aug-2007 06:13 | - | |
| Temporary Forever/ | 09-Aug-2007 06:46 | - | |
| Tetsu Inoue/ | 08-Aug-2007 13:02 | - | |
| The Beastie Boys/ | 23-Jun-2007 04:36 | - | |
| The Black Dog/ | 23-Jun-2007 04:36 | - | |
| The Chemical Brothers/ | 23-Jun-2007 04:37 | - | |
| The Ends Against the Middle/ | 23-Jun-2007 04:37 | - | |
| The Faint/ | 23-Jun-2007 04:37 | - | |
| The Future Sound Of London/ | 23-Jun-2007 04:37 | - | |
| The Futureheads/ | 23-Jun-2007 04:37 | - | |
| The Herbaliser/ | 23-Jun-2007 04:37 | - | |
| The Immortal Otis Redding/ | 23-Jun-2007 04:38 | - | |
| The Isolationist/ | 23-Jun-2007 04:38 | - | |
| The Orb/ | 23-Jun-2007 04:38 | - | |
| The Prodigy/ | 23-Jun-2007 04:38 | - | |
| The Quick and the Dead/ | 23-Jun-2007 04:38 | - | |
| The Rapture/ | 23-Jun-2007 04:38 | - | |
| The Smiths/ | 23-Jun-2007 04:38 | - | |
| The Strokes/ | 23-Jun-2007 04:38 | - | |
| The Temptations/ | 23-Jun-2007 04:38 | - | |
| The White Stripes/ | 23-Jun-2007 04:38 | - | |
| The Wild Beescht/ | 23-Jun-2007 04:38 | - | |
| The flaming lips/ | 23-Jun-2007 04:37 | - | |
| Thelonious_Monk/ | 23-Jun-2007 04:38 | - | |
| Thom Yorke - The Eraser/ | 23-Jun-2007 04:39 | - | |
| Thrills/ | 23-Jun-2007 04:39 | - | |
| Tim Exile/ | 23-Jun-2007 04:39 | - | |
| Tom Waits/ | 23-Jun-2007 04:39 | - | |
| UNKLE/ | 23-Jun-2007 04:41 | - | |
| Unfound Sound/ | 23-Jun-2007 04:40 | - | |
| Unknown Artist/ | 23-Jun-2007 04:41 | - | |
| VA_-_Transloco_Express-2002-gEm/ | 23-Jun-2007 04:41 | - | |
| Vincent Gallo/ | 23-Jun-2007 04:42 | - | |
| Vocal Studies and Uprock Narratives/ | 23-Jun-2007 04:43 | - | |
| Volkov Trio/ | 23-Jun-2007 04:43 | - | |
| Von Haussowolff/ | 23-Jun-2007 04:43 | - | |
| Warp Records & London Sinfonietta/ | 23-Jun-2007 04:43 | - | |
| Warp Works & 20th Century Masters/ | 23-Jun-2007 04:43 | - | |
| Wevie Stonder/ | 23-Jun-2007 04:43 | - | |
| Xen Cuts/ | 23-Jun-2007 04:43 | - | |
| Xenakis/ | 23-Jun-2007 04:44 | - | |
| Yann Tiersen/ | 23-Jun-2007 04:44 | - | |
| Yellow Swans/ | 23-Jun-2007 04:44 | - | |
| Yeterday's New Quintet/ | 23-Jun-2007 04:44 | - | |
| Yonderboi/ | 23-Jun-2007 04:44 | - | |
| Yusef Lateef/ | 23-Jun-2007 04:44 | - | |
| Zakir Hussain/ | 23-Jun-2007 04:44 | - | |
| Zoviet France/ | 23-Jun-2007 04:45 | - | |
| _Zoviet_France_/ | 23-Jun-2007 04:45 | - | |
| aarktica/ | 23-Jun-2007 03:24 | - | |
| akira soundtrack/ | 23-Jun-2007 03:31 | - | |
| analog pussy/ | 23-Jun-2007 03:32 | - | |
| anthony rother/ | 23-Jun-2007 03:32 | - | |
| apparat organ quartet .2002.[lp] -apparat organ quarte/ | 23-Jun-2007 03:33 | - | |
| art of noise/ | 23-Jun-2007 03:34 | - | |
| astrobotnia/ | 23-Jun-2007 03:34 | - | |
| beyond the pale/ | 23-Jun-2007 03:36 | - | |
| big daddy kane/ | 23-Jun-2007 03:36 | - | |
| bladow/ | 23-Jun-2007 03:37 | - | |
| blevin blectum/ | 23-Jun-2007 03:37 | - | |
| bloc party/ | 23-Jun-2007 03:37 | - | |
| blonde redhead/ | 23-Jun-2007 03:37 | - | |
| bonobo/ | 23-Jun-2007 03:39 | - | |
| breakbeat era/ | 23-Jun-2007 03:39 | - | |
| brothomstates/ | 23-Jun-2007 03:40 | - | |
| bukowski/ | 23-Jun-2007 03:40 | - | |
| ceephax acid crew untitled 2000/ | 23-Jun-2007 03:41 | - | |
| chanson francaise/ | 23-Jun-2007 03:41 | - | |
| charlie parker/ | 23-Jun-2007 03:42 | - | |
| chris clark/ | 23-Jun-2007 03:42 | - | |
| cinematic orchestra/ | 23-Jun-2007 03:42 | - | |
| clicks & cuts 2 disc 3/ | 23-Jun-2007 03:45 | - | |
| cocorosie/ | 23-Jun-2007 03:46 | - | |
| dDamage/ | 23-Jun-2007 03:47 | - | |
| diplo/ | 23-Jun-2007 03:49 | - | |
| dirty mixes/ | 23-Jun-2007 03:49 | - | |
| dntel/ | 23-Jun-2007 03:52 | - | |
| doormouse/ | 23-Jun-2007 03:53 | - | |
| dot allison/ | 23-Jun-2007 03:53 | - | |
| duo 505/ | 23-Jun-2007 03:53 | - | |
| dykehouse/ | 23-Jun-2007 03:53 | - | |
| edith piaf/ | 23-Jun-2007 03:54 | - | |
| erik truffaz/ | 23-Jun-2007 03:54 | - | |
| fever - red bedroom/ | 23-Jun-2007 03:55 | - | |
| four tet/ | 23-Jun-2007 03:56 | - | |
| gabriel ananda/ | 23-Jun-2007 03:56 | - | |
| goodiepal/ | 23-Jun-2007 03:58 | - | |
| goran bregovic/ | 19-Jul-2007 02:11 | - | |
| gravediggaz - 6 feet deep/ | 23-Jun-2007 03:58 | - | |
| herbie hancock/ | 23-Jun-2007 03:58 | - | |
| hum/ | 23-Jun-2007 03:59 | - | |
| illogic/ | 23-Jun-2007 04:00 | - | |
| immortal technique - revolutionary vol. 2/ | 23-Jun-2007 04:00 | - | |
| james figurine/ | 23-Jun-2007 04:01 | - | |
| james lavelle/ | 23-Jun-2007 04:01 | - | |
| jean michel jarre/ | 23-Jun-2007 04:02 | - | |
| jesse stiles/ | 23-Jun-2007 04:03 | - | |
| jimmy edgar/ | 23-Jun-2007 04:03 | - | |
| john coltrane/ | 23-Jun-2007 04:04 | - | |
| joshua redman/ | 23-Jun-2007 04:04 | - | |
| kafka fragments/ | 23-Jun-2007 04:05 | - | |
| kid koala/ | 23-Jun-2007 04:05 | - | |
| kid spatula/ | 23-Jun-2007 04:05 | - | |
| kim cascone/ | 23-Jun-2007 04:06 | - | |
| kings of convenience/ | 23-Jun-2007 04:06 | - | |
| kondo, laswell, bernocchi/ | 23-Jun-2007 04:06 | - | |
| kraftwerk/ | 23-Jun-2007 04:07 | - | |
| laurie anderson/ | 23-Jun-2007 04:09 | - | |
| le groove eclectique - a chilled out voy/ | 23-Jun-2007 04:09 | - | |
| machine drum/ | 23-Jun-2007 04:12 | - | |
| midwest product/ | 23-Jun-2007 04:16 | - | |
| mira calix/ | 23-Jun-2007 04:17 | - | |
| music in the middle east/ | 23-Jun-2007 04:19 | - | |
| new order - technique (1989)/ | 23-Jun-2007 04:19 | - | |
| nocturnal emissions & origami vs. manipu/ | 23-Jun-2007 04:20 | - | |
| optometry/ | 23-Jun-2007 04:20 | - | |
| out hud/ | 23-Jun-2007 04:21 | - | |
| ovuca/ | 23-Jun-2007 04:21 | - | |
| pan_tone/ | 23-Jun-2007 04:21 | - | |
| phoenecia/ | 23-Jun-2007 04:22 | - | |
| pierre henry/ | 23-Jun-2007 04:23 | - | |
| plaid/ | 23-Jun-2007 04:23 | - | |
| portishead/ | 23-Jun-2007 04:25 | - | |
| propellerheads/ | 23-Jun-2007 04:26 | - | |
| sage francis a healthy distrust 2004/ | 23-Jun-2007 04:29 | - | |
| secret chiefs 3/ | 23-Jun-2007 04:29 | - | |
| solvent/ | 08-Aug-2007 14:23 | - | |
| stereoC64/ | 09-Aug-2007 02:52 | - | |
| steve reich/ | 09-Aug-2007 03:27 | - | |
| superpitcher/ | 09-Aug-2007 04:20 | - | |
| swans - 1991 - white light from the mouth of infinity [160 fhg js]/ | 09-Aug-2007 05:44 | - | |
| team doyobi/ | 09-Aug-2007 06:16 | - | |
| team shadetek/ | 09-Aug-2007 06:34 | - | |
| telefon tel aviv/ | 09-Aug-2007 06:34 | - | |
| tetsu inoue & taylor deupree/ | 23-Jun-2007 04:36 | - | |
| the_diplomats-diplomatic_immunity_2/ | 23-Jun-2007 04:39 | - | |
| thomas bangalter/ | 23-Jun-2007 04:39 | - | |
| todd reynolds/ | 23-Jun-2007 04:39 | - | |
| tracy + the plastics/ | 23-Jun-2007 04:39 | - | |
| tricky/ | 23-Jun-2007 04:39 | - | |
| venetian snares/ | 23-Jun-2007 04:42 | - | |
| vitalic/ | 23-Jun-2007 04:42 | - | |
| vlasdislav delay/ | 23-Jun-2007 04:43 | - | |